Products 2803456-00-8
CAS 2803456-00-8 is the registry number for 4-((4-Bromophenyl)sulfonyl)-1,2-difluorobenzene, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-(4-bromophenyl)sulfonyl-1,2-difluorobenzene (CAS 2803456-00-8) is a chemical compound with the molecular formula C12H7BrF2O2S and a molecular weight of 333.15 g/mol. IUPAC name: 4-(4-bromophenyl)sulfonyl-1,2-difluorobenzene. InChIKey: IBPHQWWCMWEPRO-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF2O2S |
|---|---|
| Molecular weight | 333.15 g/mol |
| IUPAC name | 4-(4-bromophenyl)sulfonyl-1,2-difluorobenzene |
| InChIKey | IBPHQWWCMWEPRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C2=CC(=C(C=C2)F)F)Br |
Computed by PubChem (NCBI)