CAS 2803461-05-2 is the registry number for tert-butyl (2R,4S)-4-benzyloxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg.
3-(4-phenoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 2803461-05-2) is a chemical compound with the molecular formula C20H19N5O and a molecular weight of 345.4 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: MNSPOLYONYCORF-UHFFFAOYSA-N.
| Molecular formula | C20H19N5O |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | MNSPOLYONYCORF-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=NC=NC(=C2C(=N1)C3=CC=C(C=C3)OC4=CC=CC=C4)N |
Computed by PubChem (NCBI)