Products 2803476-99-3
CAS 2803476-99-3 is the registry number for 2-(3-(4-Bromophenyl)-4-methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)acetic acid, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[3-(4-bromophenyl)-4-methyl-2-oxobenzimidazol-1-yl]acetic acid (CAS 2803476-99-3) is a chemical compound with the molecular formula C16H13BrN2O3 and a molecular weight of 361.19 g/mol. IUPAC name: 2-[3-(4-bromophenyl)-4-methyl-2-oxobenzimidazol-1-yl]acetic acid. InChIKey: OGKZHQHRXNGKOK-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2O3 |
|---|---|
| Molecular weight | 361.19 g/mol |
| IUPAC name | 2-[3-(4-bromophenyl)-4-methyl-2-oxobenzimidazol-1-yl]acetic acid |
| InChIKey | OGKZHQHRXNGKOK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N(C(=O)N2C3=CC=C(C=C3)Br)CC(=O)O |
Computed by PubChem (NCBI)