Products 2803478-66-0
CAS 2803478-66-0 is the registry number for Dacomitinib impurity 4, 97.53%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 50 mg.
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide (CAS 2803478-66-0) is a chemical compound with the molecular formula C19H16ClFN4O2 and a molecular weight of 386.8 g/mol. IUPAC name: (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide. InChIKey: IFVNWQCRARJXCD-ONEGZZNKSA-N.
| Molecular formula | C19H16ClFN4O2 |
|---|---|
| Molecular weight | 386.8 g/mol |
| IUPAC name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide |
| InChIKey | IFVNWQCRARJXCD-ONEGZZNKSA-N |
| SMILES | C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)OC |
Computed by PubChem (NCBI)