CAS 2803879-60-7 is the registry number for GSPT1 degrader-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(3-chloro-4-methylphenyl)carbamate (CAS 2803879-60-7) is a chemical compound with the molecular formula C22H20ClN3O5 and a molecular weight of 441.9 g/mol. IUPAC name: [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(3-chloro-4-methylphenyl)carbamate. InChIKey: VCEJNBKFGYUOAV-UHFFFAOYSA-N.
| Molecular formula | C22H20ClN3O5 |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(3-chloro-4-methylphenyl)carbamate |
| InChIKey | VCEJNBKFGYUOAV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)OCC2=CC3=C(CN(C3=O)C4CCC(=O)NC4=O)C=C2)Cl |
Computed by PubChem (NCBI)