CAS 2803933-39-1 is the registry number for (R)-1-(3-Bromo-5-(1,1-difluoroethyl)phenyl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethanamine (CAS 2803933-39-1) is a chemical compound with the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. IUPAC name: (1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethanamine. InChIKey: IWKPJUNZYZPFRS-ZCFIWIBFSA-N.
| Molecular formula | C10H12BrF2N |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | (1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethanamine |
| InChIKey | IWKPJUNZYZPFRS-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)Br)C(C)(F)F)N |
Computed by PubChem (NCBI)