CAS 2806729-75-7 is the registry number for ethyl (2S,4S,5S)-5-hydroxy-2-methyl-piperidine-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl (2S,4S,5S)-5-hydroxy-2-methylpiperidine-4-carboxylate (CAS 2806729-75-7) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: ethyl (2S,4S,5S)-5-hydroxy-2-methylpiperidine-4-carboxylate. InChIKey: QZLKVVIHGBWBFH-BIIVOSGPSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | ethyl (2S,4S,5S)-5-hydroxy-2-methylpiperidine-4-carboxylate |
| InChIKey | QZLKVVIHGBWBFH-BIIVOSGPSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H](NC[C@H]1O)C |
Computed by PubChem (NCBI)