CAS 2806738-93-0 is the registry number for rel-(R)-6,6-Dimethylpiperidin-3-amine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3R)-6,6-dimethylpiperidin-3-amine;dihydrochloride (CAS 2806738-93-0) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (3R)-6,6-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: RQONNEOLTVCZGY-QYCVXMPOSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (3R)-6,6-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | RQONNEOLTVCZGY-QYCVXMPOSA-N |
| SMILES | CC1(CC[C@H](CN1)N)C.Cl.Cl |
Computed by PubChem (NCBI)