CAS 2806762-69-4 is the registry number for SORT1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-ylcarbamoyl)-5-(trifluoromethyl)benzoic acid (CAS 2806762-69-4) is a chemical compound with the molecular formula C17H13F3N2O4 and a molecular weight of 366.29 g/mol. IUPAC name: 2-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-ylcarbamoyl)-5-(trifluoromethyl)benzoic acid. InChIKey: NILRIZWEOLEABR-UHFFFAOYSA-N.
| Molecular formula | C17H13F3N2O4 |
|---|---|
| Molecular weight | 366.29 g/mol |
| IUPAC name | 2-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-2-ylcarbamoyl)-5-(trifluoromethyl)benzoic acid |
| InChIKey | NILRIZWEOLEABR-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C=CC(=N2)NC(=O)C3=C(C=C(C=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)