CAS 2807444-86-4 is the registry number for 2-(Benzyloxy)-3,5-dibromo-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,5-dibromo-3-phenyl-2-phenylmethoxybenzene (CAS 2807444-86-4) is a chemical compound with the molecular formula C19H14Br2O and a molecular weight of 418.1 g/mol. IUPAC name: 1,5-dibromo-3-phenyl-2-phenylmethoxybenzene. InChIKey: MDLIXFLPLQMNCA-UHFFFAOYSA-N.
| Molecular formula | C19H14Br2O |
|---|---|
| Molecular weight | 418.1 g/mol |
| IUPAC name | 1,5-dibromo-3-phenyl-2-phenylmethoxybenzene |
| InChIKey | MDLIXFLPLQMNCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)