CAS 2807464-45-3 is the registry number for 5-Bromo-2,3-difluoro-4-iodobenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2,3-difluoro-4-iodobenzaldehyde (CAS 2807464-45-3) is a chemical compound with the molecular formula C7H2BrF2IO and a molecular weight of 346.89 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-iodobenzaldehyde. InChIKey: UZTKXRNGGRZHAB-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF2IO |
|---|---|
| Molecular weight | 346.89 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-iodobenzaldehyde |
| InChIKey | UZTKXRNGGRZHAB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)I)F)F)C=O |
Computed by PubChem (NCBI)