CAS 280758-01-2 appears in our catalog under these names: (S)-tert-Butyl (4-methyl-1-oxopentan-3-yl)carbamate, 95%, (S)-tert-Butyl (4-methyl-1-oxopentan-3-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl N-[(3S)-4-methyl-1-oxopentan-3-yl]carbamate (CAS 280758-01-2) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-[(3S)-4-methyl-1-oxopentan-3-yl]carbamate. InChIKey: OBWNQXOVRLYCEL-VIFPVBQESA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-[(3S)-4-methyl-1-oxopentan-3-yl]carbamate |
| InChIKey | OBWNQXOVRLYCEL-VIFPVBQESA-N |
| SMILES | CC(C)[C@H](CC=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)