Products 280783-56-4
CAS 280783-56-4 appears in our catalog under these names: Ro 64–6198, Ro 64-6198, Ro 64-6198, 99.82%, 99.82%, Ro 64-6198, 99.82%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 10 mg, 5 mg.
8-[(1S,3aS)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (CAS 280783-56-4) is a chemical compound with the molecular formula C26H31N3O and a molecular weight of 401.5 g/mol. IUPAC name: 8-[(1S,3aS)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one. InChIKey: JLFMYEAXZNPWBK-REWPJTCUSA-N.
| Molecular formula | C26H31N3O |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 8-[(1S,3aS)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| InChIKey | JLFMYEAXZNPWBK-REWPJTCUSA-N |
| SMILES | C1C[C@H]2CC[C@@H](C3=CC=CC(=C23)C1)N4CCC5(CC4)C(=O)NCN5C6=CC=CC=C6 |
Computed by PubChem (NCBI)