CAS 28081-12-1 appears in our catalog under these names: 3-(4-Chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one, 95+%, 4-Chloro-4'-fluorochalcone, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 5g, 25g.
(E)-3-(4-chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one (CAS 28081-12-1) is a chemical compound with the molecular formula C15H10ClFO and a molecular weight of 260.69 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one. InChIKey: WXGUVJMPLPVNHX-XCVCLJGOSA-N.
| Molecular formula | C15H10ClFO |
|---|---|
| Molecular weight | 260.69 g/mol |
| IUPAC name | (E)-3-(4-chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | WXGUVJMPLPVNHX-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)F)Cl |
Computed by PubChem (NCBI)