CAS 2808651-95-6 is the registry number for Fmoc-L-Pro(4-CF2H)-OH (2S,4S). Offered by: Iris Biotech. Available pack sizes: 1g, 100mg, 250mg.
(2S,4S)-4-(difluoromethyl)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 2808651-95-6) is a chemical compound with the molecular formula C21H19F2NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (2S,4S)-4-(difluoromethyl)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: OHPRQUANEKWCRB-SGTLLEGYSA-N.
| Molecular formula | C21H19F2NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S,4S)-4-(difluoromethyl)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | OHPRQUANEKWCRB-SGTLLEGYSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(F)F |
Computed by PubChem (NCBI)