CAS 2350073-06-0 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(3,3-difluorocyclobutyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3,3-difluorocyclobutyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 2350073-06-0) is a chemical compound with the molecular formula C21H19F2NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (2R)-2-(3,3-difluorocyclobutyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: NJEQLTVNRMWSMS-GOSISDBHSA-N.
| Molecular formula | C21H19F2NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2R)-2-(3,3-difluorocyclobutyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | NJEQLTVNRMWSMS-GOSISDBHSA-N |
| SMILES | C1C(CC1(F)F)[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)