Products 2808653-93-0
CAS 2808653-93-0 is the registry number for DNP-PEG2-NHS ester. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]propanoate (CAS 2808653-93-0) is a chemical compound with the molecular formula C17H20N4O10 and a molecular weight of 440.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]propanoate. InChIKey: SDLCOOUHDFFHSC-UHFFFAOYSA-N.
| Molecular formula | C17H20N4O10 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]propanoate |
| InChIKey | SDLCOOUHDFFHSC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
DNP-PEG2-NHS ester, orb3137672