Products 2810050-73-6
CAS 2810050-73-6 is the registry number for tert-Butyl (2S,4R)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,4R)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate (CAS 2810050-73-6) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (2S,4R)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: GRUBQHUBZNSRIH-RQJHMYQMSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (2S,4R)-2-(difluoromethyl)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | GRUBQHUBZNSRIH-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(F)F)O |
Computed by PubChem (NCBI)