CAS 2810137-86-9 is the registry number for XOR/URAT1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-(3-chloroanilino)-3-pyridinyl]-2-hydroxybenzoic acid (CAS 2810137-86-9) is a chemical compound with the molecular formula C18H13ClN2O3 and a molecular weight of 340.8 g/mol. IUPAC name: 4-[5-(3-chloroanilino)-3-pyridinyl]-2-hydroxybenzoic acid. InChIKey: KITCGABOPRSTRW-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN2O3 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 4-[5-(3-chloroanilino)-3-pyridinyl]-2-hydroxybenzoic acid |
| InChIKey | KITCGABOPRSTRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC2=CN=CC(=C2)C3=CC(=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)