CAS 28116-26-9 is the registry number for N-Acetyltyramine Glucuronide. Offered by: TRC. Available pack sizes: 250mg.
(2S,3S,4S,5R,6S)-6-[4-(2-acetamidoethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 28116-26-9) is a chemical compound with the molecular formula C16H21NO8 and a molecular weight of 355.34 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[4-(2-acetamidoethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: DDAQSNRNVPNZJX-JHZZJYKESA-N.
| Molecular formula | C16H21NO8 |
|---|---|
| Molecular weight | 355.34 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[4-(2-acetamidoethyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | DDAQSNRNVPNZJX-JHZZJYKESA-N |
| SMILES | CC(=O)NCCC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)