CAS 281211-64-1 is the registry number for 4,4-Dimethyl-N-(3-(trifluoromethyl)phenyl)-4,5-dihydro-1,3-thiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4,4-dimethyl-N-[3-(trifluoromethyl)phenyl]-5H-1,3-thiazol-2-amine (CAS 281211-64-1) is a chemical compound with the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. IUPAC name: 4,4-dimethyl-N-[3-(trifluoromethyl)phenyl]-5H-1,3-thiazol-2-amine. InChIKey: CIZBLFDLXGYQGQ-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2S |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 4,4-dimethyl-N-[3-(trifluoromethyl)phenyl]-5H-1,3-thiazol-2-amine |
| InChIKey | CIZBLFDLXGYQGQ-UHFFFAOYSA-N |
| SMILES | CC1(CSC(=N1)NC2=CC=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)