CAS 28128-33-8 appears in our catalog under these names: 8-Aminoadenine, 8–Aminoadenine, 8-Aminoadenine, 98.34%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 25 mg.
7H-purine-6,8-diamine (CAS 28128-33-8) is a chemical compound with the molecular formula C5H6N6 and a molecular weight of 150.14 g/mol. IUPAC name: 7H-purine-6,8-diamine. InChIKey: PFUVOLUPRFCPMN-UHFFFAOYSA-N.
| Molecular formula | C5H6N6 |
|---|---|
| Molecular weight | 150.14 g/mol |
| IUPAC name | 7H-purine-6,8-diamine |
| InChIKey | PFUVOLUPRFCPMN-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N=C(N2)N)N |
Computed by PubChem (NCBI)