CAS 2814-60-0 is the registry number for 3,3'-Diethyl-2,2'-azinodibenzothiazole. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 2000mg.
(E)-3-ethyl-N-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine (CAS 2814-60-0) is a chemical compound with the molecular formula C18H18N4S2 and a molecular weight of 354.5 g/mol. IUPAC name: (E)-3-ethyl-N-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine. InChIKey: CPOBTYJRKAJERX-YAFCTCPESA-N.
| Molecular formula | C18H18N4S2 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | (E)-3-ethyl-N-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine |
| InChIKey | CPOBTYJRKAJERX-YAFCTCPESA-N |
| SMILES | CCN\1C2=CC=CC=C2S/C1=N/N=C\3/N(C4=CC=CC=C4S3)CC |
Computed by PubChem (NCBI)