Products 28141-24-4

CAS 28141-24-4 is the registry number for 4-Hydroxybenzoyl Chloride. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

4-hydroxybenzoyl chloride (CAS 28141-24-4) is a chemical compound with the molecular formula C7H5ClO2 and a molecular weight of 156.56 g/mol. IUPAC name: 4-hydroxybenzoyl chloride. InChIKey: YIPHYCQSJTXLFM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClO2
Molecular weight156.56 g/mol
IUPAC name4-hydroxybenzoyl chloride
InChIKeyYIPHYCQSJTXLFM-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)Cl)O

Computed by PubChem (NCBI)