CAS 2814500-04-2 appears in our catalog under these names: (4-(3,6-Diphenyl-9H-carbazol-9-yl)butyl)phosphonic acid, >99%, Ph-4PACz 98%, (4-(3,6-Diphenyl-9H-carbazol-9-yl)butyl)phosphonic acid, 98%, 98%, Ph-4PACz, 98%. Offered by: Lumtec, Ambeed, Chemat, Fluorochem. Available pack sizes: On request, 50mg, 100mg, 250mg, 1g, 5g.
4-(3,6-diphenylcarbazol-9-yl)butylphosphonic acid (CAS 2814500-04-2) is a chemical compound with the molecular formula C28H26NO3P and a molecular weight of 455.5 g/mol. IUPAC name: 4-(3,6-diphenylcarbazol-9-yl)butylphosphonic acid. InChIKey: JUZXTPFZIJMYBS-UHFFFAOYSA-N.
| Molecular formula | C28H26NO3P |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | 4-(3,6-diphenylcarbazol-9-yl)butylphosphonic acid |
| InChIKey | JUZXTPFZIJMYBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=C3C=C(C=C4)C5=CC=CC=C5)CCCCP(=O)(O)O |
Computed by PubChem (NCBI)