Products 2814540-76-4
CAS 2814540-76-4 appears in our catalog under these names: ATP synthase inhibitor 2, ATP synthase inhibitor 2, ATP synthase inhibitor 2, 99%, 99%, ATP synthase inhibitor 2, 99.93%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 5mg, 5 mg, 10 mg, 50 mg.
Methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylsulfanylquinolin-3-yl)methylamino]propanoate (CAS 2814540-76-4) is a chemical compound with the molecular formula C21H22N2O3S and a molecular weight of 382.5 g/mol. IUPAC name: methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylsulfanylquinolin-3-yl)methylamino]propanoate. InChIKey: WIDVPHSBAXLSEU-IBGZPJMESA-N.
| Molecular formula | C21H22N2O3S |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylsulfanylquinolin-3-yl)methylamino]propanoate |
| InChIKey | WIDVPHSBAXLSEU-IBGZPJMESA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)O)NCC2=CC3=CC=CC=C3N=C2SC |
Computed by PubChem (NCBI)