Products 2816817-76-0
CAS 2816817-76-0 is the registry number for tert-Butyl (1S,4S)-6-oxo-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1S,4S)-6-oxo-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (CAS 2816817-76-0) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: tert-butyl (1S,4S)-6-oxo-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: UMGMECYEEYWYKD-BQBZGAKWSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | tert-butyl (1S,4S)-6-oxo-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | UMGMECYEEYWYKD-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1C(=O)N2 |
Computed by PubChem (NCBI)