Products 2816914-01-7
CAS 2816914-01-7 is the registry number for tert-Butyl 7-bromo-4-(tert-butoxy)-5-fluoro-1H-indole-1-carboxylate. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 7-bromo-5-fluoro-4-[(2-methylpropan-2-yl)oxy]indole-1-carboxylate (CAS 2816914-01-7) is a chemical compound with the molecular formula C17H21BrFNO3 and a molecular weight of 386.3 g/mol. IUPAC name: tert-butyl 7-bromo-5-fluoro-4-[(2-methylpropan-2-yl)oxy]indole-1-carboxylate. InChIKey: NKILUEVSKVDPEU-UHFFFAOYSA-N.
| Molecular formula | C17H21BrFNO3 |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | tert-butyl 7-bromo-5-fluoro-4-[(2-methylpropan-2-yl)oxy]indole-1-carboxylate |
| InChIKey | NKILUEVSKVDPEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C2C=CN(C2=C(C=C1F)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)