CAS 2816967-14-1 is the registry number for Mpro ligand 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
CAS 2816967-14-1 identifies a chemical compound with the molecular formula C24H33N3NaO9S and a molecular weight of 562.6 g/mol. InChIKey: WAJHNKZVPRUTAU-OVFFYUQJSA-N.
| Molecular formula | C24H33N3NaO9S |
|---|---|
| Molecular weight | 562.6 g/mol |
| InChIKey | WAJHNKZVPRUTAU-OVFFYUQJSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](C[C@@H]1CCNC1=O)[C@H](O)S(=O)(=O)O)NC(=O)OCC2=CC=C(C=C2)OCC#C.[Na] |
Computed by PubChem (NCBI)