CAS 28170-13-0 appears in our catalog under these names: Potassium thiobenzoate, 95%, Potassium thiobenzoate, 95% , Benzenecarbothioic acid, potassium salt 95+%, Benzenecarbothioic acid, potassium salt, 95+%, 95+%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Potassium thiobenzate (CAS 28170-13-0) is a chemical compound with the molecular formula C7H5KOS and a molecular weight of 176.28 g/mol. IUPAC name: potassium thiobenzate. InChIKey: LKFCPWBGBPJDRC-UHFFFAOYSA-M.
| Molecular formula | C7H5KOS |
|---|---|
| Molecular weight | 176.28 g/mol |
| IUPAC name | potassium thiobenzate |
| InChIKey | LKFCPWBGBPJDRC-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(=S)[O-].[K+] |
Computed by PubChem (NCBI)