CAS 2817635-53-1 is the registry number for 6-Chloro-1,1a,3,7b-tetrahydro-2H-cyclopropa[c]quinolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1,1a,3,7b-tetrahydrocyclopropa[c]quinolin-2-one (CAS 2817635-53-1) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 6-chloro-1,1a,3,7b-tetrahydrocyclopropa[c]quinolin-2-one. InChIKey: PTBBIYLDKKRLQD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 6-chloro-1,1a,3,7b-tetrahydrocyclopropa[c]quinolin-2-one |
| InChIKey | PTBBIYLDKKRLQD-UHFFFAOYSA-N |
| SMILES | C1C2C1C(=O)NC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)