CAS 28178-42-9 appears in our catalog under these names: 2,6-Diisopropylphenyl isocyanate, 94% , 2,6-Diisopropylphenylisocyanate 97%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
2-isocyanato-1,3-di(propan-2-yl)benzene (CAS 28178-42-9) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 2-isocyanato-1,3-di(propan-2-yl)benzene. InChIKey: FEUFNKALUGDEMQ-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 2-isocyanato-1,3-di(propan-2-yl)benzene |
| InChIKey | FEUFNKALUGDEMQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N=C=O |
Computed by PubChem (NCBI)