Products 28179-17-1

CAS 28179-17-1 is the registry number for Daclatasvir Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2,2-dibromo-1-[4-[4-(2,2-dibromoacetyl)phenyl]phenyl]ethanone (CAS 28179-17-1) is a chemical compound with the molecular formula C16H10Br4O2 and a molecular weight of 553.9 g/mol. IUPAC name: 2,2-dibromo-1-[4-[4-(2,2-dibromoacetyl)phenyl]phenyl]ethanone. InChIKey: LVIMIMKGJLGWDD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10Br4O2
Molecular weight553.9 g/mol
IUPAC name2,2-dibromo-1-[4-[4-(2,2-dibromoacetyl)phenyl]phenyl]ethanone
InChIKeyLVIMIMKGJLGWDD-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC=C(C=C2)C(=O)C(Br)Br)C(=O)C(Br)Br

Computed by PubChem (NCBI)