CAS 2818959-86-1 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-sulfonyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-sulfonyl fluoride (CAS 2818959-86-1) is a chemical compound with the molecular formula C16H18BFO4S and a molecular weight of 336.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-sulfonyl fluoride. InChIKey: XZAXTIIAYNNHTC-UHFFFAOYSA-N.
| Molecular formula | C16H18BFO4S |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1-sulfonyl fluoride |
| InChIKey | XZAXTIIAYNNHTC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)S(=O)(=O)F |
Computed by PubChem (NCBI)