Products 2820191-48-6
CAS 2820191-48-6 is the registry number for tert-Butyl (4aR,8aR)-octahydro-1,5-naphthyridine-1(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridine-1-carboxylate (CAS 2820191-48-6) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl (4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridine-1-carboxylate. InChIKey: NJASRKUXYJXBNQ-GHMZBOCLSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl (4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-1,5-naphthyridine-1-carboxylate |
| InChIKey | NJASRKUXYJXBNQ-GHMZBOCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2[C@H]1CCCN2 |
Computed by PubChem (NCBI)