Products 2820501-20-8
CAS 2820501-20-8 is the registry number for CRBN ligand-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione (CAS 2820501-20-8) is a chemical compound with the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. IUPAC name: 3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione. InChIKey: NNWGGPWDAGWZAT-UHFFFAOYSA-N.
| Molecular formula | C15H16F2N2O3 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione |
| InChIKey | NNWGGPWDAGWZAT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2F)N3CC(C3)CO)F |
Computed by PubChem (NCBI)
Synonyms:
CRBN ligand-12, orb2944947