Products 2820536-79-4
CAS 2820536-79-4 appears in our catalog under these names: 2-amino-4-bromo-3,5,6-trifluoro-benzamide, 95%, 2-Amino-4-bromo-3,5,6-trifluorobenzamide, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-amino-4-bromo-3,5,6-trifluorobenzamide (CAS 2820536-79-4) is a chemical compound with the molecular formula C7H4BrF3N2O and a molecular weight of 269.02 g/mol. IUPAC name: 2-amino-4-bromo-3,5,6-trifluorobenzamide. InChIKey: WMFZBILFPXUBFN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3N2O |
|---|---|
| Molecular weight | 269.02 g/mol |
| IUPAC name | 2-amino-4-bromo-3,5,6-trifluorobenzamide |
| InChIKey | WMFZBILFPXUBFN-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)Br)F)N)C(=O)N |
Computed by PubChem (NCBI)