CAS 2820537-13-9 is the registry number for Ethyl (7aS)-2-hydroxy-5-oxotetrahydro-1H-pyrrolizine-7a(5H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (8S)-2-hydroxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (CAS 2820537-13-9) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: ethyl (8S)-2-hydroxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate. InChIKey: QNPREYCLSIKNDU-MHPPCMCBSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | ethyl (8S)-2-hydroxy-5-oxo-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| InChIKey | QNPREYCLSIKNDU-MHPPCMCBSA-N |
| SMILES | CCOC(=O)[C@@]12CCC(=O)N1CC(C2)O |
Computed by PubChem (NCBI)