CAS 2821797-69-5 is the registry number for 2-(Trimethylsilyl)ethyl (S)-3-hydroxypyrrolidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-trimethylsilylethyl (3S)-3-hydroxypyrrolidine-1-carboxylate (CAS 2821797-69-5) is a chemical compound with the molecular formula C10H21NO3Si and a molecular weight of 231.36 g/mol. IUPAC name: 2-trimethylsilylethyl (3S)-3-hydroxypyrrolidine-1-carboxylate. InChIKey: CCVYKYGHUNTQRX-VIFPVBQESA-N.
| Molecular formula | C10H21NO3Si |
|---|---|
| Molecular weight | 231.36 g/mol |
| IUPAC name | 2-trimethylsilylethyl (3S)-3-hydroxypyrrolidine-1-carboxylate |
| InChIKey | CCVYKYGHUNTQRX-VIFPVBQESA-N |
| SMILES | C[Si](C)(C)CCOC(=O)N1CC[C@@H](C1)O |
Computed by PubChem (NCBI)