CAS 28223-61-2 is the registry number for (R)-2-(5-(Dimethylamino)naphthalene-1-sulfonamido)-3-sulfopropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-sulfopropanoic acid (CAS 28223-61-2) is a chemical compound with the molecular formula C15H18N2O7S2 and a molecular weight of 402.4 g/mol. IUPAC name: 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-sulfopropanoic acid. InChIKey: ZVOGQJUKPIENKH-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O7S2 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-sulfopropanoic acid |
| InChIKey | ZVOGQJUKPIENKH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NC(CS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)