CAS 28230-32-2 appears in our catalog under these names: HODHBt/ 99.99%, HOOBt, HODHBt, 99.97%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 100mg, 200mg, 500mg, 100g, 25g, 10mM/1mL, 100 g, 50 g.
3-hydroxy-1,2,3-benzotriazin-4-one (CAS 28230-32-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-hydroxy-1,2,3-benzotriazin-4-one. InChIKey: HJBLUNHMOKFZQX-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-hydroxy-1,2,3-benzotriazin-4-one |
| InChIKey | HJBLUNHMOKFZQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(N=N2)O |
Computed by PubChem (NCBI)