Products 2823295-37-8
CAS 2823295-37-8 is the registry number for sEH inhibitor-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1-adamantyl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea (CAS 2823295-37-8) is a chemical compound with the molecular formula C18H21F3N2O4S and a molecular weight of 418.4 g/mol. IUPAC name: 1-(1-adamantyl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea. InChIKey: SNXCHFLIKVETBL-UHFFFAOYSA-N.
| Molecular formula | C18H21F3N2O4S |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 1-(1-adamantyl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
| InChIKey | SNXCHFLIKVETBL-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)NS(=O)(=O)C4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
sEH inhibitor-17, orb2646285