CAS 2823477-69-4 is the registry number for 7-Bromo-4,6-dichloro-8-fluoro-5-methoxyquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4,6-dichloro-8-fluoro-5-methoxyquinazoline (CAS 2823477-69-4) is a chemical compound with the molecular formula C9H4BrCl2FN2O and a molecular weight of 325.95 g/mol. IUPAC name: 7-bromo-4,6-dichloro-8-fluoro-5-methoxyquinazoline. InChIKey: IRZXTNZEFPEOMF-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2FN2O |
|---|---|
| Molecular weight | 325.95 g/mol |
| IUPAC name | 7-bromo-4,6-dichloro-8-fluoro-5-methoxyquinazoline |
| InChIKey | IRZXTNZEFPEOMF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C2=C1C(=NC=N2)Cl)F)Br)Cl |
Computed by PubChem (NCBI)