CAS 28240-16-6 appears in our catalog under these names: Cefathiamidine Impurity 3, Cefathiamidine Impurity 13, Cefathiamidine Impurity 24. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-3-(acetyloxymethyl)-7-[(2-chloroacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 28240-16-6) is a chemical compound with the molecular formula C12H13ClN2O6S and a molecular weight of 348.76 g/mol. IUPAC name: (6R,7R)-3-(acetyloxymethyl)-7-[(2-chloroacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: ZKDAULRVUXKFHD-LDYMZIIASA-N.
| Molecular formula | C12H13ClN2O6S |
|---|---|
| Molecular weight | 348.76 g/mol |
| IUPAC name | (6R,7R)-3-(acetyloxymethyl)-7-[(2-chloroacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | ZKDAULRVUXKFHD-LDYMZIIASA-N |
| SMILES | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CCl)SC1)C(=O)O |
Computed by PubChem (NCBI)