Products 2824131-20-4
CAS 2824131-20-4 is the registry number for HDAC8-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[5-(hydroxycarbamoyl)-2-methoxyphenyl]dibenzofuran-4-carboxamide (CAS 2824131-20-4) is a chemical compound with the molecular formula C21H16N2O5 and a molecular weight of 376.4 g/mol. IUPAC name: N-[5-(hydroxycarbamoyl)-2-methoxyphenyl]dibenzofuran-4-carboxamide. InChIKey: RFROQVRGDKTHLN-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O5 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | N-[5-(hydroxycarbamoyl)-2-methoxyphenyl]dibenzofuran-4-carboxamide |
| InChIKey | RFROQVRGDKTHLN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NO)NC(=O)C2=CC=CC3=C2OC4=CC=CC=C34 |
Computed by PubChem (NCBI)