CAS 198572-34-8 is the registry number for 3,3-Di-(phthalimidomethyl)oxetane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]oxetan-3-yl]methyl]isoindole-1,3-dione (CAS 198572-34-8) is a chemical compound with the molecular formula C21H16N2O5 and a molecular weight of 376.4 g/mol. IUPAC name: 2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]oxetan-3-yl]methyl]isoindole-1,3-dione. InChIKey: HTFMCWNTTNUZID-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O5 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]oxetan-3-yl]methyl]isoindole-1,3-dione |
| InChIKey | HTFMCWNTTNUZID-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(CN2C(=O)C3=CC=CC=C3C2=O)CN4C(=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)