CAS 2825012-26-6 appears in our catalog under these names: 2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol dihydrochloride, 95%, 95%, 2-(Aminomethyl)-5-(4-methylthiazol-5-yl)phenol dihydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol;dihydrochloride (CAS 2825012-26-6) is a chemical compound with the molecular formula C11H14Cl2N2OS and a molecular weight of 293.2 g/mol. IUPAC name: 2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol;dihydrochloride. InChIKey: AJXKXVFOUALZFV-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2OS |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 2-(aminomethyl)-5-(4-methyl-1,3-thiazol-5-yl)phenol;dihydrochloride |
| InChIKey | AJXKXVFOUALZFV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=CC(=C(C=C2)CN)O.Cl.Cl |
Computed by PubChem (NCBI)