CAS 28251-55-0 is the registry number for 3,6-Anhydro-L-galactose. Offered by: TRC. Available pack sizes: 25mg.
(2S)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetaldehyde (CAS 28251-55-0) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. IUPAC name: (2S)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetaldehyde. InChIKey: WZYRMLAWNVOIEX-MOJAZDJTSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (2S)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetaldehyde |
| InChIKey | WZYRMLAWNVOIEX-MOJAZDJTSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H](O1)[C@@H](C=O)O)O)O |
Computed by PubChem (NCBI)