CAS 2826271-17-2 appears in our catalog under these names: (2-(3,7-Dibromo-10H-phenothiazin-10-yl)ethyl)phosphonic acid, 98%, Poly(2,5-bisoctyloxy)-1,4-phenylenevinylene). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
2-(3,7-dibromophenothiazin-10-yl)ethylphosphonic acid (CAS 2826271-17-2) is a chemical compound with the molecular formula C14H12Br2NO3PS and a molecular weight of 465.1 g/mol. IUPAC name: 2-(3,7-dibromophenothiazin-10-yl)ethylphosphonic acid. InChIKey: BHVRNHGXRPILBN-UHFFFAOYSA-N.
| Molecular formula | C14H12Br2NO3PS |
|---|---|
| Molecular weight | 465.1 g/mol |
| IUPAC name | 2-(3,7-dibromophenothiazin-10-yl)ethylphosphonic acid |
| InChIKey | BHVRNHGXRPILBN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC3=C(N2CCP(=O)(O)O)C=CC(=C3)Br |
Computed by PubChem (NCBI)