Products 2827-42-1

CAS 2827-42-1 appears in our catalog under these names: 6-morpholino-1,3,5-triazine-2,4-diamine, Morpholine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (CAS 2827-42-1) is a chemical compound with the molecular formula C7H12N6O and a molecular weight of 196.21 g/mol. IUPAC name: 6-morpholin-4-yl-1,3,5-triazine-2,4-diamine. InChIKey: SDSUSOOLEPDQPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12N6O
Molecular weight196.21 g/mol
IUPAC name6-morpholin-4-yl-1,3,5-triazine-2,4-diamine
InChIKeySDSUSOOLEPDQPJ-UHFFFAOYSA-N
SMILESC1COCCN1C2=NC(=NC(=N2)N)N

Computed by PubChem (NCBI)